C22H26O5S2 — CID 134931043
(2E)-5,5-bis(benzenesulfonyl)cyclodec-2-en-1-ol (PubChem CID 134931043) has the molecular formula C22H26O5S2 and a molecular weight of 434.58 g/mol. Its IUPAC name is (2E)-5,5-bis(benzenesulfonyl)cyclodec-2-en-1-ol.
| Compound Name | (2E)-5,5-bis(benzenesulfonyl)cyclodec-2-en-1-ol |
|---|---|
| PubChem CID | 134931043 |
| Molecular Formula | C22H26O5S2 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | (2E)-5,5-bis(benzenesulfonyl)cyclodec-2-en-1-ol |
| SMILES | O=S(=O)(c1ccccc1)C1(S(=O)(=O)c2ccccc2)C/C=C/C(O)CCCCC1 |
| InChI | InChI=1S/C22H26O5S2/c23-19-11-4-3-9-17-22(18-10-12-19,28(24,25)20-13-5-1-6-14-20)29(26,27)21-15-7-2-8-16-21/h1-2,5-8,10,12-16,19,23H,3-4,9,11,17-18H2/b12-10+ |
| InChIKey | YOEHHJNWSLWYSE-ZRDIBKRKSA-N |
| XLogP | 3.90 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|