C21H27FO5S2 — CID 169094616
1,1-bis(benzenesulfonyl)-1-fluorononan-3-ol (PubChem CID 169094616) has the molecular formula C21H27FO5S2 and a molecular weight of 442.57 g/mol. Its IUPAC name is 1,1-bis(benzenesulfonyl)-1-fluorononan-3-ol.
| Compound Name | 1,1-bis(benzenesulfonyl)-1-fluorononan-3-ol |
|---|---|
| PubChem CID | 169094616 |
| Molecular Formula | C21H27FO5S2 |
| Molecular Weight | 442.57 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | 1,1-bis(benzenesulfonyl)-1-fluorononan-3-ol |
| SMILES | CCCCCCC(O)CC(F)(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C21H27FO5S2/c1-2-3-4-7-12-18(23)17-21(22,28(24,25)19-13-8-5-9-14-19)29(26,27)20-15-10-6-11-16-20/h5-6,8-11,13-16,18,23H,2-4,7,12,17H2,1H3 |
| InChIKey | OJKNEKBOWVAPSO-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.57 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|