C16H23FO5S2 — CID 135004518
1-(2-fluoro-1,1,3,3-tetraoxo-1λ6,3λ6-benzodithiol-2-yl)nonan-1-ol (PubChem CID 135004518) has the molecular formula C16H23FO5S2 and a molecular weight of 378.49 g/mol. Its IUPAC name is 1-(2-fluoro-1,1,3,3-tetraoxo-1λ6,3λ6-benzodithiol-2-yl)nonan-1-ol.
| Compound Name | 1-(2-fluoro-1,1,3,3-tetraoxo-1λ6,3λ6-benzodithiol-2-yl)nonan-1-ol |
|---|---|
| PubChem CID | 135004518 |
| Molecular Formula | C16H23FO5S2 |
| Molecular Weight | 378.49 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | 1-(2-fluoro-1,1,3,3-tetraoxo-1λ6,3λ6-benzodithiol-2-yl)nonan-1-ol |
| SMILES | CCCCCCCCC(O)C1(F)S(=O)(=O)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C16H23FO5S2/c1-2-3-4-5-6-7-12-15(18)16(17)23(19,20)13-10-8-9-11-14(13)24(16,21)22/h8-11,15,18H,2-7,12H2,1H3 |
| InChIKey | GBEYLKAUHFOYHD-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.49 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|