C13H18F2O3S — CID 150571789
1-(benzenesulfonyl)-1,1-difluoroheptan-2-ol (PubChem CID 150571789) has the molecular formula C13H18F2O3S and a molecular weight of 292.35 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-1,1-difluoroheptan-2-ol.
| Compound Name | 1-(benzenesulfonyl)-1,1-difluoroheptan-2-ol |
|---|---|
| PubChem CID | 150571789 |
| Molecular Formula | C13H18F2O3S |
| Molecular Weight | 292.35 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 1-(benzenesulfonyl)-1,1-difluoroheptan-2-ol |
| SMILES | CCCCCC(O)C(F)(F)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C13H18F2O3S/c1-2-3-5-10-12(16)13(14,15)19(17,18)11-8-6-4-7-9-11/h4,6-9,12,16H,2-3,5,10H2,1H3 |
| InChIKey | ILZNWYAXHMGWIH-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.35 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|