C17H28O4S — CID 134983534
(3S)-2-(benzenesulfonyl)undecane-1,3-diol (PubChem CID 134983534) has the molecular formula C17H28O4S and a molecular weight of 328.47 g/mol. Its IUPAC name is (3S)-2-(benzenesulfonyl)undecane-1,3-diol.
| Compound Name | (3S)-2-(benzenesulfonyl)undecane-1,3-diol |
|---|---|
| PubChem CID | 134983534 |
| Molecular Formula | C17H28O4S |
| Molecular Weight | 328.47 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | (3S)-2-(benzenesulfonyl)undecane-1,3-diol |
| SMILES | CCCCCCCC[C@H](O)C(CO)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H28O4S/c1-2-3-4-5-6-10-13-16(19)17(14-18)22(20,21)15-11-8-7-9-12-15/h7-9,11-12,16-19H,2-6,10,13-14H2,1H3/t16-,17?/m0/s1 |
| InChIKey | OLCJQMHNQJDLAJ-BHWOMJMDSA-N |
| XLogP | 2.93 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.47 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|