C15H20F4O3S — CID 122232697
1-(benzenesulfonyl)-1,1,2,2-tetrafluorononan-3-ol (PubChem CID 122232697) has the molecular formula C15H20F4O3S and a molecular weight of 356.38 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-1,1,2,2-tetrafluorononan-3-ol.
| Compound Name | 1-(benzenesulfonyl)-1,1,2,2-tetrafluorononan-3-ol |
|---|---|
| PubChem CID | 122232697 |
| Molecular Formula | C15H20F4O3S |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | 1-(benzenesulfonyl)-1,1,2,2-tetrafluorononan-3-ol |
| SMILES | CCCCCCC(O)C(F)(F)C(F)(F)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H20F4O3S/c1-2-3-4-8-11-13(20)14(16,17)15(18,19)23(21,22)12-9-6-5-7-10-12/h5-7,9-10,13,20H,2-4,8,11H2,1H3 |
| InChIKey | ZSNAZUQJPHUEEA-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|