C15H20F2O3S — CID 11220863
1-[benzenesulfonyl(difluoro)methyl]cyclooctan-1-ol (PubChem CID 11220863) has the molecular formula C15H20F2O3S and a molecular weight of 318.38 g/mol. Its IUPAC name is 1-[benzenesulfonyl(difluoro)methyl]cyclooctan-1-ol.
| Compound Name | 1-[benzenesulfonyl(difluoro)methyl]cyclooctan-1-ol |
|---|---|
| PubChem CID | 11220863 |
| Molecular Formula | C15H20F2O3S |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 1-[benzenesulfonyl(difluoro)methyl]cyclooctan-1-ol |
| SMILES | O=S(=O)(c1ccccc1)C(F)(F)C1(O)CCCCCCC1 |
| InChI | InChI=1S/C15H20F2O3S/c16-15(17,14(18)11-7-2-1-3-8-12-14)21(19,20)13-9-5-4-6-10-13/h4-6,9-10,18H,1-3,7-8,11-12H2 |
| InChIKey | RIZWRQNKSMRINC-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |