C13H16F2OS — CID 11230657
1-[difluoro(phenylsulfanyl)methyl]cyclohexan-1-ol (PubChem CID 11230657) has the molecular formula C13H16F2OS and a molecular weight of 258.33 g/mol. Its IUPAC name is 1-[difluoro(phenylsulfanyl)methyl]cyclohexan-1-ol.
| Compound Name | 1-[difluoro(phenylsulfanyl)methyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 11230657 |
| Molecular Formula | C13H16F2OS |
| Molecular Weight | 258.33 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 1-[difluoro(phenylsulfanyl)methyl]cyclohexan-1-ol |
| SMILES | OC1(C(F)(F)Sc2ccccc2)CCCCC1 |
| InChI | InChI=1S/C13H16F2OS/c14-13(15,12(16)9-5-2-6-10-12)17-11-7-3-1-4-8-11/h1,3-4,7-8,16H,2,5-6,9-10H2 |
| InChIKey | UABLCIXQCJLXIO-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.33 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |