C20H32F2O3S — CID 11474785
7-[benzenesulfonyl(difluoro)methyl]tridecan-7-ol (PubChem CID 11474785) has the molecular formula C20H32F2O3S and a molecular weight of 390.54 g/mol. Its IUPAC name is 7-[benzenesulfonyl(difluoro)methyl]tridecan-7-ol.
| Compound Name | 7-[benzenesulfonyl(difluoro)methyl]tridecan-7-ol |
|---|---|
| PubChem CID | 11474785 |
| Molecular Formula | C20H32F2O3S |
| Molecular Weight | 390.54 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | 7-[benzenesulfonyl(difluoro)methyl]tridecan-7-ol |
| SMILES | CCCCCCC(O)(CCCCCC)C(F)(F)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H32F2O3S/c1-3-5-7-12-16-19(23,17-13-8-6-4-2)20(21,22)26(24,25)18-14-10-9-11-15-18/h9-11,14-15,23H,3-8,12-13,16-17H2,1-2H3 |
| InChIKey | HHPCGIJUJGAETF-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.54 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|