C17H24F2O3S — CID 11359958
1-[benzenesulfonyl(difluoro)methyl]-4-tert-butylcyclohexan-1-ol (PubChem CID 11359958) has the molecular formula C17H24F2O3S and a molecular weight of 346.44 g/mol. Its IUPAC name is 1-[benzenesulfonyl(difluoro)methyl]-4-tert-butylcyclohexan-1-ol.
| Compound Name | 1-[benzenesulfonyl(difluoro)methyl]-4-tert-butylcyclohexan-1-ol |
|---|---|
| PubChem CID | 11359958 |
| Molecular Formula | C17H24F2O3S |
| Molecular Weight | 346.44 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 1-[benzenesulfonyl(difluoro)methyl]-4-tert-butylcyclohexan-1-ol |
| SMILES | CC(C)(C)C1CCC(O)(C(F)(F)S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C17H24F2O3S/c1-15(2,3)13-9-11-16(20,12-10-13)17(18,19)23(21,22)14-7-5-4-6-8-14/h4-8,13,20H,9-12H2,1-3H3 |
| InChIKey | IPLUFKPBVBIHNI-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.44 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |