C21H24F2O3S — CID 58344122
2-[3-[[4-(2,4-difluorophenyl)phenyl]sulfonylmethyl]cyclopentyl]propan-2-ol (PubChem CID 58344122) has the molecular formula C21H24F2O3S and a molecular weight of 394.48 g/mol. Its IUPAC name is 2-[3-[[4-(2,4-difluorophenyl)phenyl]sulfonylmethyl]cyclopentyl]propan-2-ol.
| Compound Name | 2-[3-[[4-(2,4-difluorophenyl)phenyl]sulfonylmethyl]cyclopentyl]propan-2-ol |
|---|---|
| PubChem CID | 58344122 |
| Molecular Formula | C21H24F2O3S |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | 2-[3-[[4-(2,4-difluorophenyl)phenyl]sulfonylmethyl]cyclopentyl]propan-2-ol |
| SMILES | CC(C)(O)C1CCC(CS(=O)(=O)c2ccc(-c3ccc(F)cc3F)cc2)C1 |
| InChI | InChI=1S/C21H24F2O3S/c1-21(2,24)16-6-3-14(11-16)13-27(25,26)18-8-4-15(5-9-18)19-10-7-17(22)12-20(19)23/h4-5,7-10,12,14,16,24H,3,6,11,13H2,1-2H3 |
| InChIKey | OQVQWXCPICNOTB-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |