C22H26F2O3S — CID 58344108
2-[4-[[4-(2,4-difluorophenyl)phenyl]sulfonylmethyl]cyclohexyl]propan-2-ol (PubChem CID 58344108) has the molecular formula C22H26F2O3S and a molecular weight of 408.51 g/mol. Its IUPAC name is 2-[4-[[4-(2,4-difluorophenyl)phenyl]sulfonylmethyl]cyclohexyl]propan-2-ol.
| Compound Name | 2-[4-[[4-(2,4-difluorophenyl)phenyl]sulfonylmethyl]cyclohexyl]propan-2-ol |
|---|---|
| PubChem CID | 58344108 |
| Molecular Formula | C22H26F2O3S |
| Molecular Weight | 408.51 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | 2-[4-[[4-(2,4-difluorophenyl)phenyl]sulfonylmethyl]cyclohexyl]propan-2-ol |
| SMILES | CC(C)(O)C1CCC(CS(=O)(=O)c2ccc(-c3ccc(F)cc3F)cc2)CC1 |
| InChI | InChI=1S/C22H26F2O3S/c1-22(2,25)17-7-3-15(4-8-17)14-28(26,27)19-10-5-16(6-11-19)20-12-9-18(23)13-21(20)24/h5-6,9-13,15,17,25H,3-4,7-8,14H2,1-2H3 |
| InChIKey | PLGVKGWKWCYHNW-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.51 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |