C15H14F2O3S — CID 134849150
2-(4-fluorophenyl)-1-(4-fluorophenyl)sulfonylpropan-2-ol (PubChem CID 134849150) has the molecular formula C15H14F2O3S and a molecular weight of 312.34 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-1-(4-fluorophenyl)sulfonylpropan-2-ol.
| Compound Name | 2-(4-fluorophenyl)-1-(4-fluorophenyl)sulfonylpropan-2-ol |
|---|---|
| PubChem CID | 134849150 |
| Molecular Formula | C15H14F2O3S |
| Molecular Weight | 312.34 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | 2-(4-fluorophenyl)-1-(4-fluorophenyl)sulfonylpropan-2-ol |
| SMILES | CC(O)(CS(=O)(=O)c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H14F2O3S/c1-15(18,11-2-4-12(16)5-3-11)10-21(19,20)14-8-6-13(17)7-9-14/h2-9,18H,10H2,1H3 |
| InChIKey | YYTXVFOXBRIQAL-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.34 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |