C15H12ClF3O3S — CID 52941171
2-[4-(2-chlorophenyl)sulfonylphenyl]-1,1,1-trifluoropropan-2-ol (PubChem CID 52941171) has the molecular formula C15H12ClF3O3S and a molecular weight of 364.77 g/mol. Its IUPAC name is 2-[4-(2-chlorophenyl)sulfonylphenyl]-1,1,1-trifluoropropan-2-ol.
| Compound Name | 2-[4-(2-chlorophenyl)sulfonylphenyl]-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 52941171 |
| Molecular Formula | C15H12ClF3O3S |
| Molecular Weight | 364.77 g/mol |
| Exact Mass | 364.01 |
| IUPAC Name | 2-[4-(2-chlorophenyl)sulfonylphenyl]-1,1,1-trifluoropropan-2-ol |
| SMILES | CC(O)(c1ccc(S(=O)(=O)c2ccccc2Cl)cc1)C(F)(F)F |
| InChI | InChI=1S/C15H12ClF3O3S/c1-14(20,15(17,18)19)10-6-8-11(9-7-10)23(21,22)13-5-3-2-4-12(13)16/h2-9,20H,1H3 |
| InChIKey | HEYYMMKRFXWVJQ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.77 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |