C15H15ClO3S — CID 11688174
2-[4-(2-chlorophenyl)sulfonylphenyl]propan-2-ol (PubChem CID 11688174) has the molecular formula C15H15ClO3S and a molecular weight of 310.80 g/mol. Its IUPAC name is 2-[4-(2-chlorophenyl)sulfonylphenyl]propan-2-ol.
| Compound Name | 2-[4-(2-chlorophenyl)sulfonylphenyl]propan-2-ol |
|---|---|
| PubChem CID | 11688174 |
| Molecular Formula | C15H15ClO3S |
| Molecular Weight | 310.80 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | 2-[4-(2-chlorophenyl)sulfonylphenyl]propan-2-ol |
| SMILES | CC(C)(O)c1ccc(S(=O)(=O)c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C15H15ClO3S/c1-15(2,17)11-7-9-12(10-8-11)20(18,19)14-6-4-3-5-13(14)16/h3-10,17H,1-2H3 |
| InChIKey | RCKMIFPXYXDXBN-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.80 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |