C17H16F4O3S — CID 122232699
1-(benzenesulfonyl)-1,1,2,2-tetrafluoro-5-phenylpentan-3-ol (PubChem CID 122232699) has the molecular formula C17H16F4O3S and a molecular weight of 376.37 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-1,1,2,2-tetrafluoro-5-phenylpentan-3-ol.
| Compound Name | 1-(benzenesulfonyl)-1,1,2,2-tetrafluoro-5-phenylpentan-3-ol |
|---|---|
| PubChem CID | 122232699 |
| Molecular Formula | C17H16F4O3S |
| Molecular Weight | 376.37 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | 1-(benzenesulfonyl)-1,1,2,2-tetrafluoro-5-phenylpentan-3-ol |
| SMILES | O=S(=O)(c1ccccc1)C(F)(F)C(F)(F)C(O)CCc1ccccc1 |
| InChI | InChI=1S/C17H16F4O3S/c18-16(19,15(22)12-11-13-7-3-1-4-8-13)17(20,21)25(23,24)14-9-5-2-6-10-14/h1-10,15,22H,11-12H2 |
| InChIKey | GMGYEXAMMCAUSK-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.37 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|