C17H21F3O3S2 — CID 134932117
(6-butyl-2-phenylsulfanylcyclohexen-1-yl) trifluoromethanesulfonate (PubChem CID 134932117) has the molecular formula C17H21F3O3S2 and a molecular weight of 394.48 g/mol. Its IUPAC name is (6-butyl-2-phenylsulfanylcyclohexen-1-yl) trifluoromethanesulfonate.
| Compound Name | (6-butyl-2-phenylsulfanylcyclohexen-1-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 134932117 |
| Molecular Formula | C17H21F3O3S2 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | (6-butyl-2-phenylsulfanylcyclohexen-1-yl) trifluoromethanesulfonate |
| SMILES | CCCCC1CCCC(Sc2ccccc2)=C1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C17H21F3O3S2/c1-2-3-8-13-9-7-12-15(24-14-10-5-4-6-11-14)16(13)23-25(21,22)17(18,19)20/h4-6,10-11,13H,2-3,7-9,12H2,1H3 |
| InChIKey | GHXFZHXZAQXSOD-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|