C15H20F2O2S — CID 163297793
(3-cyclohexyl-1,1-difluoropropyl)sulfonylbenzene (PubChem CID 163297793) has the molecular formula C15H20F2O2S and a molecular weight of 302.39 g/mol. Its IUPAC name is (3-cyclohexyl-1,1-difluoropropyl)sulfonylbenzene.
| Compound Name | (3-cyclohexyl-1,1-difluoropropyl)sulfonylbenzene |
|---|---|
| PubChem CID | 163297793 |
| Molecular Formula | C15H20F2O2S |
| Molecular Weight | 302.39 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | (3-cyclohexyl-1,1-difluoropropyl)sulfonylbenzene |
| SMILES | O=S(=O)(c1ccccc1)C(F)(F)CCC1CCCCC1 |
| InChI | InChI=1S/C15H20F2O2S/c16-15(17,12-11-13-7-3-1-4-8-13)20(18,19)14-9-5-2-6-10-14/h2,5-6,9-10,13H,1,3-4,7-8,11-12H2 |
| InChIKey | VJCBKPGNGLJGBQ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.39 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |