C14H18F2O2S — CID 163297731
[difluoro-(2-methylcyclohexyl)methyl]sulfonylbenzene (PubChem CID 163297731) has the molecular formula C14H18F2O2S and a molecular weight of 288.36 g/mol. Its IUPAC name is [difluoro-(2-methylcyclohexyl)methyl]sulfonylbenzene.
| Compound Name | [difluoro-(2-methylcyclohexyl)methyl]sulfonylbenzene |
|---|---|
| PubChem CID | 163297731 |
| Molecular Formula | C14H18F2O2S |
| Molecular Weight | 288.36 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | [difluoro-(2-methylcyclohexyl)methyl]sulfonylbenzene |
| SMILES | CC1CCCCC1C(F)(F)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C14H18F2O2S/c1-11-7-5-6-10-13(11)14(15,16)19(17,18)12-8-3-2-4-9-12/h2-4,8-9,11,13H,5-7,10H2,1H3 |
| InChIKey | QDSHEBGHAJMZNN-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.36 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |