C17H20F2O2S — CID 135063106
[1,1-difluoro-2-(4-prop-1-en-2-ylcyclohexen-1-yl)ethyl]sulfonylbenzene (PubChem CID 135063106) has the molecular formula C17H20F2O2S and a molecular weight of 326.41 g/mol. Its IUPAC name is [1,1-difluoro-2-(4-prop-1-en-2-ylcyclohexen-1-yl)ethyl]sulfonylbenzene.
| Compound Name | [1,1-difluoro-2-(4-prop-1-en-2-ylcyclohexen-1-yl)ethyl]sulfonylbenzene |
|---|---|
| PubChem CID | 135063106 |
| Molecular Formula | C17H20F2O2S |
| Molecular Weight | 326.41 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | [1,1-difluoro-2-(4-prop-1-en-2-ylcyclohexen-1-yl)ethyl]sulfonylbenzene |
| SMILES | C=C(C)C1CC=C(CC(F)(F)S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C17H20F2O2S/c1-13(2)15-10-8-14(9-11-15)12-17(18,19)22(20,21)16-6-4-3-5-7-16/h3-8,15H,1,9-12H2,2H3 |
| InChIKey | ZKOVDPOALCUWCS-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.41 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|