C15H22F2O2S — CID 163297700
(1,1-difluoro-2-propylhexyl)sulfonylbenzene (PubChem CID 163297700) has the molecular formula C15H22F2O2S and a molecular weight of 304.40 g/mol. Its IUPAC name is (1,1-difluoro-2-propylhexyl)sulfonylbenzene.
| Compound Name | (1,1-difluoro-2-propylhexyl)sulfonylbenzene |
|---|---|
| PubChem CID | 163297700 |
| Molecular Formula | C15H22F2O2S |
| Molecular Weight | 304.40 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | (1,1-difluoro-2-propylhexyl)sulfonylbenzene |
| SMILES | CCCCC(CCC)C(F)(F)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H22F2O2S/c1-3-5-10-13(9-4-2)15(16,17)20(18,19)14-11-7-6-8-12-14/h6-8,11-13H,3-5,9-10H2,1-2H3 |
| InChIKey | PCGUZPRFCITZKK-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.40 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |