C14H20F2O3S — CID 11162560
1-(benzenesulfonyl)-1,1-difluorooctan-2-ol (PubChem CID 11162560) has the molecular formula C14H20F2O3S and a molecular weight of 306.37 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-1,1-difluorooctan-2-ol.
| Compound Name | 1-(benzenesulfonyl)-1,1-difluorooctan-2-ol |
|---|---|
| PubChem CID | 11162560 |
| Molecular Formula | C14H20F2O3S |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | 1-(benzenesulfonyl)-1,1-difluorooctan-2-ol |
| SMILES | CCCCCCC(O)C(F)(F)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C14H20F2O3S/c1-2-3-4-8-11-13(17)14(15,16)20(18,19)12-9-6-5-7-10-12/h5-7,9-10,13,17H,2-4,8,11H2,1H3 |
| InChIKey | GYTGDGUTCKSKQE-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|