C27H37ClO5S2 — CID 11103513
[(3S)-1-(benzenesulfonyl)-3-[(E)-6-chlorohex-4-en-3-yl]oxynonyl]sulfonylbenzene (PubChem CID 11103513) has the molecular formula C27H37ClO5S2 and a molecular weight of 541.18 g/mol. Its IUPAC name is [(3S)-1-(benzenesulfonyl)-3-[(E)-6-chlorohex-4-en-3-yl]oxynonyl]sulfonylbenzene.
| Compound Name | [(3S)-1-(benzenesulfonyl)-3-[(E)-6-chlorohex-4-en-3-yl]oxynonyl]sulfonylbenzene |
|---|---|
| PubChem CID | 11103513 |
| Molecular Formula | C27H37ClO5S2 |
| Molecular Weight | 541.18 g/mol |
| Exact Mass | 540.18 |
| IUPAC Name | [(3S)-1-(benzenesulfonyl)-3-[(E)-6-chlorohex-4-en-3-yl]oxynonyl]sulfonylbenzene |
| SMILES | CCCCCC[C@@H](CC(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1)OC(/C=C/CCl)CC |
| InChI | InChI=1S/C27H37ClO5S2/c1-3-5-6-9-15-24(33-23(4-2)16-14-21-28)22-27(34(29,30)25-17-10-7-11-18-25)35(31,32)26-19-12-8-13-20-26/h7-8,10-14,16-20,23-24,27H,3-6,9,15,21-22H2,1-2H3/b16-14+/t23?,24-/m0/s1 |
| InChIKey | ZFXLYRQZAALFCV-HXXXTPIOSA-N |
| XLogP | 6.58 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.18 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|