C29H40O7S2 — CID 11017205
ethyl (E)-4-[(3S)-1,1-bis(benzenesulfonyl)nonan-3-yl]oxyhex-2-enoate (PubChem CID 11017205) has the molecular formula C29H40O7S2 and a molecular weight of 564.77 g/mol. Its IUPAC name is ethyl (E)-4-[(3S)-1,1-bis(benzenesulfonyl)nonan-3-yl]oxyhex-2-enoate.
| Compound Name | ethyl (E)-4-[(3S)-1,1-bis(benzenesulfonyl)nonan-3-yl]oxyhex-2-enoate |
|---|---|
| PubChem CID | 11017205 |
| Molecular Formula | C29H40O7S2 |
| Molecular Weight | 564.77 g/mol |
| Exact Mass | 564.22 |
| IUPAC Name | ethyl (E)-4-[(3S)-1,1-bis(benzenesulfonyl)nonan-3-yl]oxyhex-2-enoate |
| SMILES | CCCCCC[C@@H](CC(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1)OC(/C=C/C(=O)OCC)CC |
| InChI | InChI=1S/C29H40O7S2/c1-4-7-8-11-16-25(36-24(5-2)21-22-28(30)35-6-3)23-29(37(31,32)26-17-12-9-13-18-26)38(33,34)27-19-14-10-15-20-27/h9-10,12-15,17-22,24-25,29H,4-8,11,16,23H2,1-3H3/b22-21+/t24?,25-/m0/s1 |
| InChIKey | DHKAQUVFRPSKJV-RLTYTMOBSA-N |
| XLogP | 5.90 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.77 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|