C31H34F2O7S2 — CID 91545010
8-[2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetyl]oxyoctyl prop-2-enoate (PubChem CID 91545010) has the molecular formula C31H34F2O7S2 and a molecular weight of 620.74 g/mol. Its IUPAC name is 8-[2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetyl]oxyoctyl prop-2-enoate.
| Compound Name | 8-[2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetyl]oxyoctyl prop-2-enoate |
|---|---|
| PubChem CID | 91545010 |
| Molecular Formula | C31H34F2O7S2 |
| Molecular Weight | 620.74 g/mol |
| Exact Mass | 620.17 |
| IUPAC Name | 8-[2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetyl]oxyoctyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCCCCOC(=O)C(F)(F)S(=O)(=O)OS(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H34F2O7S2/c1-2-29(34)38-24-16-5-3-4-6-17-25-39-30(35)31(32,33)42(36,37)40-41(26-18-10-7-11-19-26,27-20-12-8-13-21-27)28-22-14-9-15-23-28/h2,7-15,18-23H,1,3-6,16-17,24-25H2 |
| InChIKey | AASVDOOOXCOGGX-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.74 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|