C25H20F6O5S2 — CID 86665358
(4-fluorophenyl)-diphenylsulfanium;1,1,3,3,3-pentafluoro-2-(2-methylprop-2-enoyloxy)propane-1-sulfonate (PubChem CID 86665358) has the molecular formula C25H20F6O5S2 and a molecular weight of 578.55 g/mol. Its IUPAC name is (4-fluorophenyl)-diphenylsulfanium;1,1,3,3,3-pentafluoro-2-(2-methylprop-2-enoyloxy)propane-1-sulfonate.
| Compound Name | (4-fluorophenyl)-diphenylsulfanium;1,1,3,3,3-pentafluoro-2-(2-methylprop-2-enoyloxy)propane-1-sulfonate |
|---|---|
| PubChem CID | 86665358 |
| Molecular Formula | C25H20F6O5S2 |
| Molecular Weight | 578.55 g/mol |
| Exact Mass | 578.07 |
| IUPAC Name | (4-fluorophenyl)-diphenylsulfanium;1,1,3,3,3-pentafluoro-2-(2-methylprop-2-enoyloxy)propane-1-sulfonate |
| SMILES | C=C(C)C(=O)OC(C(F)(F)F)C(F)(F)S(=O)(=O)[O-].Fc1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H14FS.C7H7F5O5S/c19-15-11-13-18(14-12-15)20(16-7-3-1-4-8-16)17-9-5-2-6-10-17;1-3(2)4(13)17-5(6(8,9)10)7(11,12)18(14,15)16/h1-14H;5H,1H2,2H3,(H,14,15,16)/q+1;/p-1 |
| InChIKey | IDVAVTGPFUWFRW-UHFFFAOYSA-M |
| XLogP | 6.10 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.55 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|