C23H21F5O5S — CID 10577438
[(1E,4E)-4-(benzenesulfonyl)-5-ethoxy-6,6,7,7,7-pentafluoro-1-phenylhepta-1,4-dien-3-yl] acetate (PubChem CID 10577438) has the molecular formula C23H21F5O5S and a molecular weight of 504.47 g/mol. Its IUPAC name is [(1E,4E)-4-(benzenesulfonyl)-5-ethoxy-6,6,7,7,7-pentafluoro-1-phenylhepta-1,4-dien-3-yl] acetate.
| Compound Name | [(1E,4E)-4-(benzenesulfonyl)-5-ethoxy-6,6,7,7,7-pentafluoro-1-phenylhepta-1,4-dien-3-yl] acetate |
|---|---|
| PubChem CID | 10577438 |
| Molecular Formula | C23H21F5O5S |
| Molecular Weight | 504.47 g/mol |
| Exact Mass | 504.10 |
| IUPAC Name | [(1E,4E)-4-(benzenesulfonyl)-5-ethoxy-6,6,7,7,7-pentafluoro-1-phenylhepta-1,4-dien-3-yl] acetate |
| SMILES | CCO/C(=C(\C(/C=C/c1ccccc1)OC(C)=O)S(=O)(=O)c1ccccc1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C23H21F5O5S/c1-3-32-21(22(24,25)23(26,27)28)20(34(30,31)18-12-8-5-9-13-18)19(33-16(2)29)15-14-17-10-6-4-7-11-17/h4-15,19H,3H2,1-2H3/b15-14+,21-20+ |
| InChIKey | GYMZDQHXCAMXFY-SMOVNBQISA-N |
| XLogP | 5.55 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.47 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|