C20H19F3O5S — CID 10836269
[(E)-2-(benzenesulfonyl)-3-ethoxy-4,4,4-trifluoro-1-phenylbut-2-enyl] acetate (PubChem CID 10836269) has the molecular formula C20H19F3O5S and a molecular weight of 428.43 g/mol. Its IUPAC name is [(E)-2-(benzenesulfonyl)-3-ethoxy-4,4,4-trifluoro-1-phenylbut-2-enyl] acetate.
| Compound Name | [(E)-2-(benzenesulfonyl)-3-ethoxy-4,4,4-trifluoro-1-phenylbut-2-enyl] acetate |
|---|---|
| PubChem CID | 10836269 |
| Molecular Formula | C20H19F3O5S |
| Molecular Weight | 428.43 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | [(E)-2-(benzenesulfonyl)-3-ethoxy-4,4,4-trifluoro-1-phenylbut-2-enyl] acetate |
| SMILES | CCO/C(=C(\C(OC(C)=O)c1ccccc1)S(=O)(=O)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C20H19F3O5S/c1-3-27-19(20(21,22)23)18(29(25,26)16-12-8-5-9-13-16)17(28-14(2)24)15-10-6-4-7-11-15/h4-13,17H,3H2,1-2H3/b19-18+ |
| InChIKey | CSFPWQBLIRAONV-VHEBQXMUSA-N |
| XLogP | 4.58 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.43 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|