C18H16F2O5S — CID 132564563
[3,3-difluoro-2-(4-methylphenyl)sulfonyloxy-1-phenylprop-2-enyl] acetate (PubChem CID 132564563) has the molecular formula C18H16F2O5S and a molecular weight of 382.38 g/mol. Its IUPAC name is [3,3-difluoro-2-(4-methylphenyl)sulfonyloxy-1-phenylprop-2-enyl] acetate.
| Compound Name | [3,3-difluoro-2-(4-methylphenyl)sulfonyloxy-1-phenylprop-2-enyl] acetate |
|---|---|
| PubChem CID | 132564563 |
| Molecular Formula | C18H16F2O5S |
| Molecular Weight | 382.38 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | [3,3-difluoro-2-(4-methylphenyl)sulfonyloxy-1-phenylprop-2-enyl] acetate |
| SMILES | CC(=O)OC(C(OS(=O)(=O)c1ccc(C)cc1)=C(F)F)c1ccccc1 |
| InChI | InChI=1S/C18H16F2O5S/c1-12-8-10-15(11-9-12)26(22,23)25-17(18(19)20)16(24-13(2)21)14-6-4-3-5-7-14/h3-11,16H,1-2H3 |
| InChIKey | LMIBPBPKVZXBQH-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.38 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|