C17H18O5S — CID 3089973
(2-phenyl-1,3-dioxan-5-yl) 4-methylbenzenesulfonate (PubChem CID 3089973) has the molecular formula C17H18O5S and a molecular weight of 334.39 g/mol. Its IUPAC name is (2-phenyl-1,3-dioxan-5-yl) 4-methylbenzenesulfonate.
| Compound Name | (2-phenyl-1,3-dioxan-5-yl) 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 3089973 |
| Molecular Formula | C17H18O5S |
| Molecular Weight | 334.39 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | (2-phenyl-1,3-dioxan-5-yl) 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC2COC(c3ccccc3)OC2)cc1 |
| InChI | InChI=1S/C17H18O5S/c1-13-7-9-16(10-8-13)23(18,19)22-15-11-20-17(21-12-15)14-5-3-2-4-6-14/h2-10,15,17H,11-12H2,1H3 |
| InChIKey | CTEIQEFIWKXRFK-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.39 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|