C22H19F3O5S — CID 10718450
[(E)-4-(benzenesulfonyl)-5-ethoxy-6,6,6-trifluoro-1-phenylhex-4-en-1-yn-3-yl] acetate (PubChem CID 10718450) has the molecular formula C22H19F3O5S and a molecular weight of 452.45 g/mol. Its IUPAC name is [(E)-4-(benzenesulfonyl)-5-ethoxy-6,6,6-trifluoro-1-phenylhex-4-en-1-yn-3-yl] acetate.
| Compound Name | [(E)-4-(benzenesulfonyl)-5-ethoxy-6,6,6-trifluoro-1-phenylhex-4-en-1-yn-3-yl] acetate |
|---|---|
| PubChem CID | 10718450 |
| Molecular Formula | C22H19F3O5S |
| Molecular Weight | 452.45 g/mol |
| Exact Mass | 452.09 |
| IUPAC Name | [(E)-4-(benzenesulfonyl)-5-ethoxy-6,6,6-trifluoro-1-phenylhex-4-en-1-yn-3-yl] acetate |
| SMILES | CCO/C(=C(\C(C#Cc1ccccc1)OC(C)=O)S(=O)(=O)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C22H19F3O5S/c1-3-29-21(22(23,24)25)20(31(27,28)18-12-8-5-9-13-18)19(30-16(2)26)15-14-17-10-6-4-7-11-17/h4-13,19H,3H2,1-2H3/b21-20+ |
| InChIKey | ARUKLOUVHMERJS-QZQOTICOSA-N |
| XLogP | 4.25 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.45 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|