C20H18ClF3O5S — CID 101050286
[(E)-2-(4-chlorophenyl)sulfonyl-3-ethoxy-4,4,4-trifluoro-1-phenylbut-2-enyl] acetate (PubChem CID 101050286) has the molecular formula C20H18ClF3O5S and a molecular weight of 462.87 g/mol. Its IUPAC name is [(E)-2-(4-chlorophenyl)sulfonyl-3-ethoxy-4,4,4-trifluoro-1-phenylbut-2-enyl] acetate.
| Compound Name | [(E)-2-(4-chlorophenyl)sulfonyl-3-ethoxy-4,4,4-trifluoro-1-phenylbut-2-enyl] acetate |
|---|---|
| PubChem CID | 101050286 |
| Molecular Formula | C20H18ClF3O5S |
| Molecular Weight | 462.87 g/mol |
| Exact Mass | 462.05 |
| IUPAC Name | [(E)-2-(4-chlorophenyl)sulfonyl-3-ethoxy-4,4,4-trifluoro-1-phenylbut-2-enyl] acetate |
| SMILES | CCO/C(=C(\C(OC(C)=O)c1ccccc1)S(=O)(=O)c1ccc(Cl)cc1)C(F)(F)F |
| InChI | InChI=1S/C20H18ClF3O5S/c1-3-28-19(20(22,23)24)18(30(26,27)16-11-9-15(21)10-12-16)17(29-13(2)25)14-7-5-4-6-8-14/h4-12,17H,3H2,1-2H3/b19-18+ |
| InChIKey | XSTLBYPMYHAWFH-VHEBQXMUSA-N |
| XLogP | 5.23 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.87 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|