C18H17F3O4S — CID 10596293
(E)-2-(benzenesulfonyl)-3-ethoxy-4,4,4-trifluoro-1-phenylbut-2-en-1-ol (PubChem CID 10596293) has the molecular formula C18H17F3O4S and a molecular weight of 386.39 g/mol. Its IUPAC name is (E)-2-(benzenesulfonyl)-3-ethoxy-4,4,4-trifluoro-1-phenylbut-2-en-1-ol.
| Compound Name | (E)-2-(benzenesulfonyl)-3-ethoxy-4,4,4-trifluoro-1-phenylbut-2-en-1-ol |
|---|---|
| PubChem CID | 10596293 |
| Molecular Formula | C18H17F3O4S |
| Molecular Weight | 386.39 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | (E)-2-(benzenesulfonyl)-3-ethoxy-4,4,4-trifluoro-1-phenylbut-2-en-1-ol |
| SMILES | CCO/C(=C(\C(O)c1ccccc1)S(=O)(=O)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C18H17F3O4S/c1-2-25-17(18(19,20)21)16(15(22)13-9-5-3-6-10-13)26(23,24)14-11-7-4-8-12-14/h3-12,15,22H,2H2,1H3/b17-16+ |
| InChIKey | OXAPUYMBKJLPOS-WUKNDPDISA-N |
| XLogP | 4.00 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.39 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|