C19H14F6O4S — CID 11430888
2-[3,5-bis(trifluoromethyl)phenyl]sulfonylethyl (E)-3-phenylprop-2-enoate (PubChem CID 11430888) has the molecular formula C19H14F6O4S and a molecular weight of 452.37 g/mol. Its IUPAC name is 2-[3,5-bis(trifluoromethyl)phenyl]sulfonylethyl (E)-3-phenylprop-2-enoate.
| Compound Name | 2-[3,5-bis(trifluoromethyl)phenyl]sulfonylethyl (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 11430888 |
| Molecular Formula | C19H14F6O4S |
| Molecular Weight | 452.37 g/mol |
| Exact Mass | 452.05 |
| IUPAC Name | 2-[3,5-bis(trifluoromethyl)phenyl]sulfonylethyl (E)-3-phenylprop-2-enoate |
| SMILES | O=C(/C=C/c1ccccc1)OCCS(=O)(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H14F6O4S/c20-18(21,22)14-10-15(19(23,24)25)12-16(11-14)30(27,28)9-8-29-17(26)7-6-13-4-2-1-3-5-13/h1-7,10-12H,8-9H2/b7-6+ |
| InChIKey | WVJRZSILBGVLKQ-VOTSOKGWSA-N |
| XLogP | 4.75 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.37 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|