C25H24F2O4S2 — CID 58112882
[[1,1-difluoro-2-(3-methylbuta-1,3-dien-2-yloxy)ethyl]-oxido-oxo-phenyl-λ6-sulfanyl]oxy-diphenylsulfanium (PubChem CID 58112882) has the molecular formula C25H24F2O4S2 and a molecular weight of 490.59 g/mol. Its IUPAC name is [[1,1-difluoro-2-(3-methylbuta-1,3-dien-2-yloxy)ethyl]-oxido-oxo-phenyl-λ6-sulfanyl]oxy-diphenylsulfanium.
| Compound Name | [[1,1-difluoro-2-(3-methylbuta-1,3-dien-2-yloxy)ethyl]-oxido-oxo-phenyl-λ6-sulfanyl]oxy-diphenylsulfanium |
|---|---|
| PubChem CID | 58112882 |
| Molecular Formula | C25H24F2O4S2 |
| Molecular Weight | 490.59 g/mol |
| Exact Mass | 490.11 |
| IUPAC Name | [[1,1-difluoro-2-(3-methylbuta-1,3-dien-2-yloxy)ethyl]-oxido-oxo-phenyl-λ6-sulfanyl]oxy-diphenylsulfanium |
| SMILES | C=C(C)C(=C)OCC(F)(F)S(=O)([O-])(O[S+](c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H24F2O4S2/c1-20(2)21(3)30-19-25(26,27)33(28,29,24-17-11-6-12-18-24)31-32(22-13-7-4-8-14-22)23-15-9-5-10-16-23/h4-18H,1,3,19H2,2H3 |
| InChIKey | NLKUFQXGYQRXPT-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.59 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|