C26H24F4O5S2 — CID 87083647
[3,3,4,4-tetrafluoro-4-(triphenyl-λ4-sulfanyl)oxysulfonylbutyl] 2-methylprop-2-enoate (PubChem CID 87083647) has the molecular formula C26H24F4O5S2 and a molecular weight of 556.60 g/mol. Its IUPAC name is [3,3,4,4-tetrafluoro-4-(triphenyl-λ4-sulfanyl)oxysulfonylbutyl] 2-methylprop-2-enoate.
| Compound Name | [3,3,4,4-tetrafluoro-4-(triphenyl-λ4-sulfanyl)oxysulfonylbutyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 87083647 |
| Molecular Formula | C26H24F4O5S2 |
| Molecular Weight | 556.60 g/mol |
| Exact Mass | 556.10 |
| IUPAC Name | [3,3,4,4-tetrafluoro-4-(triphenyl-λ4-sulfanyl)oxysulfonylbutyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC(F)(F)C(F)(F)S(=O)(=O)OS(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H24F4O5S2/c1-20(2)24(31)34-19-18-25(27,28)26(29,30)37(32,33)35-36(21-12-6-3-7-13-21,22-14-8-4-9-15-22)23-16-10-5-11-17-23/h3-17H,1,18-19H2,2H3 |
| InChIKey | KJSKMNQGZKRMKV-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.60 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|