C27H26F6O5S2 — CID 86644256
2-(2,2-dimethylpropanoyloxy)-3,3,3-trifluoro-2-(trifluoromethyl)propane-1-sulfonate;triphenylsulfanium (PubChem CID 86644256) has the molecular formula C27H26F6O5S2 and a molecular weight of 608.62 g/mol. Its IUPAC name is 2-(2,2-dimethylpropanoyloxy)-3,3,3-trifluoro-2-(trifluoromethyl)propane-1-sulfonate;triphenylsulfanium.
| Compound Name | 2-(2,2-dimethylpropanoyloxy)-3,3,3-trifluoro-2-(trifluoromethyl)propane-1-sulfonate;triphenylsulfanium |
|---|---|
| PubChem CID | 86644256 |
| Molecular Formula | C27H26F6O5S2 |
| Molecular Weight | 608.62 g/mol |
| Exact Mass | 608.11 |
| IUPAC Name | 2-(2,2-dimethylpropanoyloxy)-3,3,3-trifluoro-2-(trifluoromethyl)propane-1-sulfonate;triphenylsulfanium |
| SMILES | CC(C)(C)C(=O)OC(CS(=O)(=O)[O-])(C(F)(F)F)C(F)(F)F.c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C9H12F6O5S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-6(2,3)5(16)20-7(8(10,11)12,9(13,14)15)4-21(17,18)19/h1-15H;4H2,1-3H3,(H,17,18,19)/q+1;/p-1 |
| InChIKey | ABYLPYGMSFJMDP-UHFFFAOYSA-M |
| XLogP | 6.77 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.62 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|