C21H22O7S2 — CID 86071804
5-[4,4-bis(benzenesulfonyl)butyl]-5-methoxyfuran-2-one (PubChem CID 86071804) has the molecular formula C21H22O7S2 and a molecular weight of 450.53 g/mol. Its IUPAC name is 5-[4,4-bis(benzenesulfonyl)butyl]-5-methoxyfuran-2-one.
| Compound Name | 5-[4,4-bis(benzenesulfonyl)butyl]-5-methoxyfuran-2-one |
|---|---|
| PubChem CID | 86071804 |
| Molecular Formula | C21H22O7S2 |
| Molecular Weight | 450.53 g/mol |
| Exact Mass | 450.08 |
| IUPAC Name | 5-[4,4-bis(benzenesulfonyl)butyl]-5-methoxyfuran-2-one |
| SMILES | COC1(CCCC(S(=O)(=O)c2ccccc2)S(=O)(=O)c2ccccc2)C=CC(=O)O1 |
| InChI | InChI=1S/C21H22O7S2/c1-27-21(16-14-19(22)28-21)15-8-13-20(29(23,24)17-9-4-2-5-10-17)30(25,26)18-11-6-3-7-12-18/h2-7,9-12,14,16,20H,8,13,15H2,1H3 |
| InChIKey | GEBBGEPEIXDLOT-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.53 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |