C22H24O7S2 — CID 135045391
[(2Z)-5,5-bis(benzenesulfonyl)octa-2,7-dienyl] methyl carbonate (PubChem CID 135045391) has the molecular formula C22H24O7S2 and a molecular weight of 464.56 g/mol. Its IUPAC name is [(2Z)-5,5-bis(benzenesulfonyl)octa-2,7-dienyl] methyl carbonate.
| Compound Name | [(2Z)-5,5-bis(benzenesulfonyl)octa-2,7-dienyl] methyl carbonate |
|---|---|
| PubChem CID | 135045391 |
| Molecular Formula | C22H24O7S2 |
| Molecular Weight | 464.56 g/mol |
| Exact Mass | 464.10 |
| IUPAC Name | [(2Z)-5,5-bis(benzenesulfonyl)octa-2,7-dienyl] methyl carbonate |
| SMILES | C=CCC(C/C=C\COC(=O)OC)(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C22H24O7S2/c1-3-16-22(17-10-11-18-29-21(23)28-2,30(24,25)19-12-6-4-7-13-19)31(26,27)20-14-8-5-9-15-20/h3-15H,1,16-18H2,2H3/b11-10- |
| InChIKey | VEQAPVRNWAOPJZ-KHPPLWFESA-N |
| XLogP | 3.94 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.56 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|