C18H26O3S — CID 134979644
[(1R,2R)-2-methoxy-4-pentylcyclohex-3-en-1-yl]sulfonylbenzene (PubChem CID 134979644) has the molecular formula C18H26O3S and a molecular weight of 322.47 g/mol. Its IUPAC name is [(1R,2R)-2-methoxy-4-pentylcyclohex-3-en-1-yl]sulfonylbenzene.
| Compound Name | [(1R,2R)-2-methoxy-4-pentylcyclohex-3-en-1-yl]sulfonylbenzene |
|---|---|
| PubChem CID | 134979644 |
| Molecular Formula | C18H26O3S |
| Molecular Weight | 322.47 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | [(1R,2R)-2-methoxy-4-pentylcyclohex-3-en-1-yl]sulfonylbenzene |
| SMILES | CCCCCC1=C[C@@H](OC)[C@H](S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C18H26O3S/c1-3-4-6-9-15-12-13-18(17(14-15)21-2)22(19,20)16-10-7-5-8-11-16/h5,7-8,10-11,14,17-18H,3-4,6,9,12-13H2,1-2H3/t17-,18-/m1/s1 |
| InChIKey | NVDXAAKWSNLNCZ-QZTJIDSGSA-N |
| XLogP | 4.14 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.47 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|