C23H40O3S2 — CID 151642863
2-(6-ethoxytridecylsulfanyl)ethylsulfonylbenzene (PubChem CID 151642863) has the molecular formula C23H40O3S2 and a molecular weight of 428.70 g/mol. Its IUPAC name is 2-(6-ethoxytridecylsulfanyl)ethylsulfonylbenzene.
| Compound Name | 2-(6-ethoxytridecylsulfanyl)ethylsulfonylbenzene |
|---|---|
| PubChem CID | 151642863 |
| Molecular Formula | C23H40O3S2 |
| Molecular Weight | 428.70 g/mol |
| Exact Mass | 428.24 |
| IUPAC Name | 2-(6-ethoxytridecylsulfanyl)ethylsulfonylbenzene |
| SMILES | CCCCCCCC(CCCCCSCCS(=O)(=O)c1ccccc1)OCC |
| InChI | InChI=1S/C23H40O3S2/c1-3-5-6-7-10-15-22(26-4-2)16-11-9-14-19-27-20-21-28(24,25)23-17-12-8-13-18-23/h8,12-13,17-18,22H,3-7,9-11,14-16,19-21H2,1-2H3 |
| InChIKey | QSWYYSCFDJCMPH-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.70 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|