C19H20O5S2 — CID 11761019
3,3-bis(benzenesulfonyl)-2-ethenyloxane (PubChem CID 11761019) has the molecular formula C19H20O5S2 and a molecular weight of 392.50 g/mol. Its IUPAC name is 3,3-bis(benzenesulfonyl)-2-ethenyloxane.
| Compound Name | 3,3-bis(benzenesulfonyl)-2-ethenyloxane |
|---|---|
| PubChem CID | 11761019 |
| Molecular Formula | C19H20O5S2 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | 3,3-bis(benzenesulfonyl)-2-ethenyloxane |
| SMILES | C=CC1OCCCC1(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H20O5S2/c1-2-18-19(14-9-15-24-18,25(20,21)16-10-5-3-6-11-16)26(22,23)17-12-7-4-8-13-17/h2-8,10-13,18H,1,9,14-15H2 |
| InChIKey | FHUQGCJLNJGSAQ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|