C19H20O5S2 — CID 15092081
[(1E,3Z)-4-(benzenesulfonyl)-5-methoxyhexa-1,3-dienyl]sulfonylbenzene (PubChem CID 15092081) has the molecular formula C19H20O5S2 and a molecular weight of 392.50 g/mol. Its IUPAC name is [(1E,3Z)-4-(benzenesulfonyl)-5-methoxyhexa-1,3-dienyl]sulfonylbenzene.
| Compound Name | [(1E,3Z)-4-(benzenesulfonyl)-5-methoxyhexa-1,3-dienyl]sulfonylbenzene |
|---|---|
| PubChem CID | 15092081 |
| Molecular Formula | C19H20O5S2 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | [(1E,3Z)-4-(benzenesulfonyl)-5-methoxyhexa-1,3-dienyl]sulfonylbenzene |
| SMILES | COC(C)/C(=C/C=C/S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H20O5S2/c1-16(24-2)19(26(22,23)18-12-7-4-8-13-18)14-9-15-25(20,21)17-10-5-3-6-11-17/h3-16H,1-2H3/b15-9+,19-14- |
| InChIKey | GHSYDDOWQRRKHF-SRGWDDTOSA-N |
| XLogP | 3.37 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|