About 6G-434S
6G-434S (PubChem CID 3524386) has the molecular formula C16H18O4S2
and a molecular weight of 338.40 g/mol. Its IUPAC name is 4-(benzenesulfonyl)butylsulfonylbenzene.
Molecular Properties
| Compound Name | 6G-434S |
| PubChem CID | 3524386 |
| Molecular Formula | C16H18O4S2 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | 4-(benzenesulfonyl)butylsulfonylbenzene |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)CCCCS(=O)(=O)C2=CC=CC=C2 |
| InChI | InChI=1S/C16H18O4S2/c17-21(18,15-9-3-1-4-10-15)13-7-8-14-22(19,20)16-11-5-2-6-12-16/h1-6,9-12H,7-8,13-14H2 |
| InChIKey | KMRBBAKYUGONDA-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 85.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | 463 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6G-434S with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6G-434S?
The IUPAC name of 6G-434S (CID 3524386) is 4-(benzenesulfonyl)butylsulfonylbenzene.
What is the SMILES notation for 6G-434S?
The canonical SMILES for 6G-434S is C1=CC=C(C=C1)S(=O)(=O)CCCCS(=O)(=O)C2=CC=CC=C2.
What is the InChIKey of 6G-434S?
The InChIKey is KMRBBAKYUGONDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18O4S2/c17-21(18,15-9-3-1-4-10-15)13-7-8-14-22(19,20)16-11-5-2-6-12-16/h1-6,9-12H,7-8,13-14H2.
What are the key properties of 6G-434S?
6G-434S has a molecular weight of 338.40 g/mol, XLogP of 2.50, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6G-434S is sourced from PubChem (CID 3524386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).