C20H22O3S2 — CID 134979645
[(3S,4R)-4-(benzenesulfonyl)-3-methoxycyclohexen-1-yl]methylsulfanylbenzene (PubChem CID 134979645) has the molecular formula C20H22O3S2 and a molecular weight of 374.53 g/mol. Its IUPAC name is [(3S,4R)-4-(benzenesulfonyl)-3-methoxycyclohexen-1-yl]methylsulfanylbenzene.
| Compound Name | [(3S,4R)-4-(benzenesulfonyl)-3-methoxycyclohexen-1-yl]methylsulfanylbenzene |
|---|---|
| PubChem CID | 134979645 |
| Molecular Formula | C20H22O3S2 |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | [(3S,4R)-4-(benzenesulfonyl)-3-methoxycyclohexen-1-yl]methylsulfanylbenzene |
| SMILES | CO[C@H]1C=C(CSc2ccccc2)CC[C@H]1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H22O3S2/c1-23-19-14-16(15-24-17-8-4-2-5-9-17)12-13-20(19)25(21,22)18-10-6-3-7-11-18/h2-11,14,19-20H,12-13,15H2,1H3/t19-,20+/m0/s1 |
| InChIKey | KWMWOBKMBWMUPY-VQTJNVASSA-N |
| XLogP | 4.36 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|