C27H38O6S2Si — CID 134928558
[(2R,3S,8E,10S)-6,6-bis(benzenesulfonyl)-10-ethyl-2-methyl-2,3,4,5,7,10-hexahydrooxecin-3-yl]oxy-trimethylsilane (PubChem CID 134928558) has the molecular formula C27H38O6S2Si and a molecular weight of 550.82 g/mol. Its IUPAC name is [(2R,3S,8E,10S)-6,6-bis(benzenesulfonyl)-10-ethyl-2-methyl-2,3,4,5,7,10-hexahydrooxecin-3-yl]oxy-trimethylsilane.
| Compound Name | [(2R,3S,8E,10S)-6,6-bis(benzenesulfonyl)-10-ethyl-2-methyl-2,3,4,5,7,10-hexahydrooxecin-3-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 134928558 |
| Molecular Formula | C27H38O6S2Si |
| Molecular Weight | 550.82 g/mol |
| Exact Mass | 550.19 |
| IUPAC Name | [(2R,3S,8E,10S)-6,6-bis(benzenesulfonyl)-10-ethyl-2-methyl-2,3,4,5,7,10-hexahydrooxecin-3-yl]oxy-trimethylsilane |
| SMILES | CC[C@H]1/C=C/CC(S(=O)(=O)c2ccccc2)(S(=O)(=O)c2ccccc2)CC[C@H](O[Si](C)(C)C)[C@@H](C)O1 |
| InChI | InChI=1S/C27H38O6S2Si/c1-6-23-14-13-20-27(34(28,29)24-15-9-7-10-16-24,35(30,31)25-17-11-8-12-18-25)21-19-26(22(2)32-23)33-36(3,4)5/h7-18,22-23,26H,6,19-21H2,1-5H3/b14-13+/t22-,23+,26+/m1/s1 |
| InChIKey | VQSBWIFFAIPKOW-LFGYQTHYSA-N |
| XLogP | 5.77 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.82 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|