C26H36O6S2Si — CID 11135298
[(2R,3S,7E,9R)-5,5-bis(benzenesulfonyl)-9-ethyl-2-methyl-3,4,6,9-tetrahydro-2H-oxonin-3-yl]oxy-trimethylsilane (PubChem CID 11135298) has the molecular formula C26H36O6S2Si and a molecular weight of 536.79 g/mol. Its IUPAC name is [(2R,3S,7E,9R)-5,5-bis(benzenesulfonyl)-9-ethyl-2-methyl-3,4,6,9-tetrahydro-2H-oxonin-3-yl]oxy-trimethylsilane.
| Compound Name | [(2R,3S,7E,9R)-5,5-bis(benzenesulfonyl)-9-ethyl-2-methyl-3,4,6,9-tetrahydro-2H-oxonin-3-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 11135298 |
| Molecular Formula | C26H36O6S2Si |
| Molecular Weight | 536.79 g/mol |
| Exact Mass | 536.17 |
| IUPAC Name | [(2R,3S,7E,9R)-5,5-bis(benzenesulfonyl)-9-ethyl-2-methyl-3,4,6,9-tetrahydro-2H-oxonin-3-yl]oxy-trimethylsilane |
| SMILES | CC[C@@H]1/C=C/CC(S(=O)(=O)c2ccccc2)(S(=O)(=O)c2ccccc2)C[C@H](O[Si](C)(C)C)[C@@H](C)O1 |
| InChI | InChI=1S/C26H36O6S2Si/c1-6-22-14-13-19-26(33(27,28)23-15-9-7-10-16-23,34(29,30)24-17-11-8-12-18-24)20-25(21(2)31-22)32-35(3,4)5/h7-18,21-22,25H,6,19-20H2,1-5H3/b14-13+/t21-,22-,25+/m1/s1 |
| InChIKey | VEVPDQYYWFQFII-YWUWNQRYSA-N |
| XLogP | 5.38 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.79 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|