C18H26O4SSi — CID 10937445
[(1R,2S,6R)-6-(benzenesulfonyl)-7-oxabicyclo[4.1.0]hept-4-en-2-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 10937445) has the molecular formula C18H26O4SSi and a molecular weight of 366.56 g/mol. Its IUPAC name is [(1R,2S,6R)-6-(benzenesulfonyl)-7-oxabicyclo[4.1.0]hept-4-en-2-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(1R,2S,6R)-6-(benzenesulfonyl)-7-oxabicyclo[4.1.0]hept-4-en-2-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10937445 |
| Molecular Formula | C18H26O4SSi |
| Molecular Weight | 366.56 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | [(1R,2S,6R)-6-(benzenesulfonyl)-7-oxabicyclo[4.1.0]hept-4-en-2-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CC=C[C@]2(S(=O)(=O)c3ccccc3)O[C@H]12 |
| InChI | InChI=1S/C18H26O4SSi/c1-17(2,3)24(4,5)22-15-12-9-13-18(16(15)21-18)23(19,20)14-10-7-6-8-11-14/h6-11,13,15-16H,12H2,1-5H3/t15-,16+,18+/m0/s1 |
| InChIKey | FEMPTQOHEMQHGG-LZLYRXPVSA-N |
| XLogP | 3.91 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.56 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|