C21H24O5SSi — CID 102257447
(1S,2S,5R,6R)-2-[(Z)-2-(benzenesulfonyl)-2-[dimethyl(phenyl)silyl]ethenyl]-3,7-dioxabicyclo[4.1.0]heptan-5-ol (PubChem CID 102257447) has the molecular formula C21H24O5SSi and a molecular weight of 416.57 g/mol. Its IUPAC name is (1S,2S,5R,6R)-2-[(Z)-2-(benzenesulfonyl)-2-[dimethyl(phenyl)silyl]ethenyl]-3,7-dioxabicyclo[4.1.0]heptan-5-ol.
| Compound Name | (1S,2S,5R,6R)-2-[(Z)-2-(benzenesulfonyl)-2-[dimethyl(phenyl)silyl]ethenyl]-3,7-dioxabicyclo[4.1.0]heptan-5-ol |
|---|---|
| PubChem CID | 102257447 |
| Molecular Formula | C21H24O5SSi |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | (1S,2S,5R,6R)-2-[(Z)-2-(benzenesulfonyl)-2-[dimethyl(phenyl)silyl]ethenyl]-3,7-dioxabicyclo[4.1.0]heptan-5-ol |
| SMILES | C[Si](C)(/C(=C/[C@@H]1OC[C@@H](O)[C@H]2O[C@H]21)S(=O)(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H24O5SSi/c1-28(2,16-11-7-4-8-12-16)19(27(23,24)15-9-5-3-6-10-15)13-18-21-20(26-21)17(22)14-25-18/h3-13,17-18,20-22H,14H2,1-2H3/b19-13+/t17-,18+,20-,21+/m1/s1 |
| InChIKey | KIUYDMAJQZRVIH-QWOIMNHXSA-N |
| XLogP | 2.03 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|