C21H26O3SSi — CID 10249577
[(1S,4S)-2-(benzenesulfonyl)-4-methoxycyclohex-2-en-1-yl]-dimethyl-phenylsilane (PubChem CID 10249577) has the molecular formula C21H26O3SSi and a molecular weight of 386.59 g/mol. Its IUPAC name is [(1S,4S)-2-(benzenesulfonyl)-4-methoxycyclohex-2-en-1-yl]-dimethyl-phenylsilane.
| Compound Name | [(1S,4S)-2-(benzenesulfonyl)-4-methoxycyclohex-2-en-1-yl]-dimethyl-phenylsilane |
|---|---|
| PubChem CID | 10249577 |
| Molecular Formula | C21H26O3SSi |
| Molecular Weight | 386.59 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | [(1S,4S)-2-(benzenesulfonyl)-4-methoxycyclohex-2-en-1-yl]-dimethyl-phenylsilane |
| SMILES | CO[C@@H]1C=C(S(=O)(=O)c2ccccc2)[C@@H]([Si](C)(C)c2ccccc2)CC1 |
| InChI | InChI=1S/C21H26O3SSi/c1-24-17-14-15-21(26(2,3)19-12-8-5-9-13-19)20(16-17)25(22,23)18-10-6-4-7-11-18/h4-13,16-17,21H,14-15H2,1-3H3/t17-,21-/m0/s1 |
| InChIKey | YDWOPNGONHDUKI-UWJYYQICSA-N |
| XLogP | 4.14 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.59 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|